About N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide
N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 110406254) has the molecular formula C15H15N3OS
and a molecular weight of 285.37 g/mol. Its IUPAC name is N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 110406254 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(-c2cccc(C(=O)NC(C)(C)C#N)c2)n1 |
| InChI | InChI=1S/C15H15N3OS/c1-10-8-20-14(17-10)12-6-4-5-11(7-12)13(19)18-15(2,3)9-16/h4-8H,1-3H3,(H,18,19) |
| InChIKey | VJVCTMHPVSGCDI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide (CID 110406254) is N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide is Cc1csc(-c2cccc(C(=O)NC(C)(C)C#N)c2)n1.
What is the InChIKey of N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is VJVCTMHPVSGCDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3OS/c1-10-8-20-14(17-10)12-6-4-5-11(7-12)13(19)18-15(2,3)9-16/h4-8H,1-3H3,(H,18,19).
What are the key properties of N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide?
N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 285.37 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanopropan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 110406254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).