About (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene
(1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene (PubChem CID 11040656) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene.
Molecular Properties
| Compound Name | (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene |
| PubChem CID | 11040656 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene |
| SMILES | C1=C[C@@H]2OC[C@H](C1)O2 |
| InChI | InChI=1S/C6H8O2/c1-2-5-4-7-6(3-1)8-5/h1,3,5-6H,2,4H2/t5-,6+/m0/s1 |
| InChIKey | JCJNEKWEHDYPMD-NTSWFWBYSA-N |
| XLogP | 0.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene?
The IUPAC name of (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene (CID 11040656) is (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene.
What is the SMILES notation for (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene?
The canonical SMILES for (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene is C1=C[C@@H]2OC[C@H](C1)O2.
What is the InChIKey of (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene?
The InChIKey is JCJNEKWEHDYPMD-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H8O2/c1-2-5-4-7-6(3-1)8-5/h1,3,5-6H,2,4H2/t5-,6+/m0/s1.
What are the key properties of (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene?
(1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene has a molecular weight of 112.13 g/mol, XLogP of 0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-6,8-dioxabicyclo[3.2.1]oct-3-ene is sourced from PubChem (CID 11040656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).