About 5-nitropyrimidine
5-nitropyrimidine (PubChem CID 11040699) has the molecular formula C4H3N3O2
and a molecular weight of 125.09 g/mol. Its IUPAC name is 5-nitropyrimidine.
Molecular Properties
| Compound Name | 5-nitropyrimidine |
| PubChem CID | 11040699 |
| Molecular Formula | C4H3N3O2 |
| Molecular Weight | 125.09 g/mol |
| Exact Mass | 125.02 |
| IUPAC Name | 5-nitropyrimidine |
| SMILES | O=[N+]([O-])c1cncnc1 |
| InChI | InChI=1S/C4H3N3O2/c8-7(9)4-1-5-3-6-2-4/h1-3H |
| InChIKey | NOYDQGFVFOQSAJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.09 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitropyrimidine?
The IUPAC name of 5-nitropyrimidine (CID 11040699) is 5-nitropyrimidine.
What is the SMILES notation for 5-nitropyrimidine?
The canonical SMILES for 5-nitropyrimidine is O=[N+]([O-])c1cncnc1.
What is the InChIKey of 5-nitropyrimidine?
The InChIKey is NOYDQGFVFOQSAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N3O2/c8-7(9)4-1-5-3-6-2-4/h1-3H.
What are the key properties of 5-nitropyrimidine?
5-nitropyrimidine has a molecular weight of 125.09 g/mol, XLogP of 0.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitropyrimidine is sourced from PubChem (CID 11040699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).