About (6E)-octa-1,6-dien-3-ol
(6E)-octa-1,6-dien-3-ol (PubChem CID 11040710) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is (6E)-octa-1,6-dien-3-ol.
Molecular Properties
| Compound Name | (6E)-octa-1,6-dien-3-ol |
| PubChem CID | 11040710 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (6E)-octa-1,6-dien-3-ol |
| SMILES | C=CC(O)CC/C=C/C |
| InChI | InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h3-5,8-9H,2,6-7H2,1H3/b5-3+ |
| InChIKey | OSLCPZYIPCXBMS-HWKANZROSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-octa-1,6-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-octa-1,6-dien-3-ol?
The IUPAC name of (6E)-octa-1,6-dien-3-ol (CID 11040710) is (6E)-octa-1,6-dien-3-ol.
What is the SMILES notation for (6E)-octa-1,6-dien-3-ol?
The canonical SMILES for (6E)-octa-1,6-dien-3-ol is C=CC(O)CC/C=C/C.
What is the InChIKey of (6E)-octa-1,6-dien-3-ol?
The InChIKey is OSLCPZYIPCXBMS-HWKANZROSA-N. The full InChI is InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h3-5,8-9H,2,6-7H2,1H3/b5-3+.
What are the key properties of (6E)-octa-1,6-dien-3-ol?
(6E)-octa-1,6-dien-3-ol has a molecular weight of 126.20 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-octa-1,6-dien-3-ol is sourced from PubChem (CID 11040710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).