About 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one
3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one (PubChem CID 11040864) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one.
Molecular Properties
| Compound Name | 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one |
| PubChem CID | 11040864 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one |
| SMILES | C=C1COC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C9H10O2/c1-6-5-11-8-4-2-3-7(10)9(6)8/h1-5H2 |
| InChIKey | BVLMIRRSTDKLTD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one?
The IUPAC name of 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one (CID 11040864) is 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one.
What is the SMILES notation for 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one?
The canonical SMILES for 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one is C=C1COC2=C1C(=O)CCC2.
What is the InChIKey of 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one?
The InChIKey is BVLMIRRSTDKLTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-6-5-11-8-4-2-3-7(10)9(6)8/h1-5H2.
What are the key properties of 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one?
3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one has a molecular weight of 150.18 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidene-6,7-dihydro-5H-1-benzofuran-4-one is sourced from PubChem (CID 11040864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).