About (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one
(4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one (PubChem CID 11040921) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one |
| PubChem CID | 11040921 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one |
| SMILES | CCCC1=CC(=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H12O3/c1-2-3-5-4-6(9)8(11)7(5)10/h4,7-8,10-11H,2-3H2,1H3/t7-,8-/m0/s1 |
| InChIKey | LFRFNLMDZHTVHB-YUMQZZPRSA-N |
| XLogP | 0.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one?
The IUPAC name of (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one (CID 11040921) is (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one.
What is the SMILES notation for (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one?
The canonical SMILES for (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one is CCCC1=CC(=O)[C@H](O)[C@H]1O.
What is the InChIKey of (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one?
The InChIKey is LFRFNLMDZHTVHB-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H12O3/c1-2-3-5-4-6(9)8(11)7(5)10/h4,7-8,10-11H,2-3H2,1H3/t7-,8-/m0/s1.
What are the key properties of (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one?
(4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one has a molecular weight of 156.18 g/mol, XLogP of 0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-4,5-dihydroxy-3-propylcyclopent-2-en-1-one is sourced from PubChem (CID 11040921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).