C17H15N3O3S — CID 110409324
N-(2,5-dimethoxyphenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 110409324) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110409324 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2csc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C17H15N3O3S/c1-22-12-3-4-15(23-2)13(9-12)19-16(21)14-10-24-17(20-14)11-5-7-18-8-6-11/h3-10H,1-2H3,(H,19,21) |
| InChIKey | XNHCSCWGEBDIQD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |