C24H30N2O2 — CID 110409373
2-(4-methylphenoxy)-1-(4-phenyl-4-pyrrolidin-1-ylpiperidin-1-yl)ethanone (PubChem CID 110409373) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-1-(4-phenyl-4-pyrrolidin-1-ylpiperidin-1-yl)ethanone.
| Compound Name | 2-(4-methylphenoxy)-1-(4-phenyl-4-pyrrolidin-1-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 110409373 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-(4-methylphenoxy)-1-(4-phenyl-4-pyrrolidin-1-ylpiperidin-1-yl)ethanone |
| SMILES | Cc1ccc(OCC(=O)N2CCC(c3ccccc3)(N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-20-9-11-22(12-10-20)28-19-23(27)25-17-13-24(14-18-25,26-15-5-6-16-26)21-7-3-2-4-8-21/h2-4,7-12H,5-6,13-19H2,1H3 |
| InChIKey | DGFJKHMKEGNBCS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |