About 6-methoxyisoquinoline
6-methoxyisoquinoline (PubChem CID 11040978) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 6-methoxyisoquinoline.
Molecular Properties
| Compound Name | 6-methoxyisoquinoline |
| PubChem CID | 11040978 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 6-methoxyisoquinoline |
| SMILES | COc1ccc2cnccc2c1 |
| InChI | InChI=1S/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3 |
| InChIKey | XZNUJESLPUNSNO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyisoquinoline?
The IUPAC name of 6-methoxyisoquinoline (CID 11040978) is 6-methoxyisoquinoline.
What is the SMILES notation for 6-methoxyisoquinoline?
The canonical SMILES for 6-methoxyisoquinoline is COc1ccc2cnccc2c1.
What is the InChIKey of 6-methoxyisoquinoline?
The InChIKey is XZNUJESLPUNSNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3.
What are the key properties of 6-methoxyisoquinoline?
6-methoxyisoquinoline has a molecular weight of 159.19 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyisoquinoline is sourced from PubChem (CID 11040978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).