C21H25NO4S — CID 110411025
(4-methoxy-3-methylphenyl)-[1-[(2-methylphenyl)methylsulfonyl]pyrrolidin-2-yl]methanone (PubChem CID 110411025) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (4-methoxy-3-methylphenyl)-[1-[(2-methylphenyl)methylsulfonyl]pyrrolidin-2-yl]methanone.
| Compound Name | (4-methoxy-3-methylphenyl)-[1-[(2-methylphenyl)methylsulfonyl]pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 110411025 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (4-methoxy-3-methylphenyl)-[1-[(2-methylphenyl)methylsulfonyl]pyrrolidin-2-yl]methanone |
| SMILES | COc1ccc(C(=O)C2CCCN2S(=O)(=O)Cc2ccccc2C)cc1C |
| InChI | InChI=1S/C21H25NO4S/c1-15-7-4-5-8-18(15)14-27(24,25)22-12-6-9-19(22)21(23)17-10-11-20(26-3)16(2)13-17/h4-5,7-8,10-11,13,19H,6,9,12,14H2,1-3H3 |
| InChIKey | OMILQSMPMOIWQN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |