C10H16O2 — CID 11041107
3-prop-1-en-2-yl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran (PubChem CID 11041107) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-prop-1-en-2-yl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran.
| Compound Name | 3-prop-1-en-2-yl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran |
|---|---|
| PubChem CID | 11041107 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 3-prop-1-en-2-yl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran |
| SMILES | C=C(C)C1COC2OCCCC21 |
| InChI | InChI=1S/C10H16O2/c1-7(2)9-6-12-10-8(9)4-3-5-11-10/h8-10H,1,3-6H2,2H3 |
| InChIKey | OFXFKPQEMUTCDI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|