C9H14O3 — CID 11041140
(2R,6R)-2,6-diethyl-5-methylidene-1,3-dioxan-4-one (PubChem CID 11041140) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (2R,6R)-2,6-diethyl-5-methylidene-1,3-dioxan-4-one.
| Compound Name | (2R,6R)-2,6-diethyl-5-methylidene-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 11041140 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2R,6R)-2,6-diethyl-5-methylidene-1,3-dioxan-4-one |
| SMILES | C=C1C(=O)O[C@H](CC)O[C@@H]1CC |
| InChI | InChI=1S/C9H14O3/c1-4-7-6(3)9(10)12-8(5-2)11-7/h7-8H,3-5H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | CLWYOQQMIQZTBY-HTQZYQBOSA-N |
| XLogP | 1.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|