C20H24FNO3S — CID 110411627
4-[(2-fluorophenoxy)methyl]-1-[(4-methylphenyl)methylsulfonyl]piperidine (PubChem CID 110411627) has the molecular formula C20H24FNO3S and a molecular weight of 377.48 g/mol. Its IUPAC name is 4-[(2-fluorophenoxy)methyl]-1-[(4-methylphenyl)methylsulfonyl]piperidine.
| Compound Name | 4-[(2-fluorophenoxy)methyl]-1-[(4-methylphenyl)methylsulfonyl]piperidine |
|---|---|
| PubChem CID | 110411627 |
| Molecular Formula | C20H24FNO3S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-[(2-fluorophenoxy)methyl]-1-[(4-methylphenyl)methylsulfonyl]piperidine |
| SMILES | Cc1ccc(CS(=O)(=O)N2CCC(COc3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C20H24FNO3S/c1-16-6-8-18(9-7-16)15-26(23,24)22-12-10-17(11-13-22)14-25-20-5-3-2-4-19(20)21/h2-9,17H,10-15H2,1H3 |
| InChIKey | ZKTMWHWEEIZTKM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |