C16H23FN2O — CID 110412011
1-[4-[2-(2-fluorophenyl)ethyl]piperazin-1-yl]-2-methylpropan-1-one (PubChem CID 110412011) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-[4-[2-(2-fluorophenyl)ethyl]piperazin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[2-(2-fluorophenyl)ethyl]piperazin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 110412011 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-[4-[2-(2-fluorophenyl)ethyl]piperazin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCN(CCc2ccccc2F)CC1 |
| InChI | InChI=1S/C16H23FN2O/c1-13(2)16(20)19-11-9-18(10-12-19)8-7-14-5-3-4-6-15(14)17/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | LELYOJUVSCNLAK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |