About trimethylsilyl 2,2-dimethylpropanoate
trimethylsilyl 2,2-dimethylpropanoate (PubChem CID 11041219) has the molecular formula C8H18O2Si
and a molecular weight of 174.32 g/mol. Its IUPAC name is trimethylsilyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | trimethylsilyl 2,2-dimethylpropanoate |
| PubChem CID | 11041219 |
| Molecular Formula | C8H18O2Si |
| Molecular Weight | 174.32 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | trimethylsilyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C8H18O2Si/c1-8(2,3)7(9)10-11(4,5)6/h1-6H3 |
| InChIKey | MKNPAZMWDJMYJS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 2,2-dimethylpropanoate?
The IUPAC name of trimethylsilyl 2,2-dimethylpropanoate (CID 11041219) is trimethylsilyl 2,2-dimethylpropanoate.
What is the SMILES notation for trimethylsilyl 2,2-dimethylpropanoate?
The canonical SMILES for trimethylsilyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 2,2-dimethylpropanoate?
The InChIKey is MKNPAZMWDJMYJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2Si/c1-8(2,3)7(9)10-11(4,5)6/h1-6H3.
What are the key properties of trimethylsilyl 2,2-dimethylpropanoate?
trimethylsilyl 2,2-dimethylpropanoate has a molecular weight of 174.32 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 2,2-dimethylpropanoate is sourced from PubChem (CID 11041219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).