C12H16O — CID 11041249
(7aS)-2-propan-2-ylidene-5,6,7,7a-tetrahydro-4H-inden-1-one (PubChem CID 11041249) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (7aS)-2-propan-2-ylidene-5,6,7,7a-tetrahydro-4H-inden-1-one.
| Compound Name | (7aS)-2-propan-2-ylidene-5,6,7,7a-tetrahydro-4H-inden-1-one |
|---|---|
| PubChem CID | 11041249 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (7aS)-2-propan-2-ylidene-5,6,7,7a-tetrahydro-4H-inden-1-one |
| SMILES | CC(C)=C1C=C2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C12H16O/c1-8(2)11-7-9-5-3-4-6-10(9)12(11)13/h7,10H,3-6H2,1-2H3/t10-/m0/s1 |
| InChIKey | XWJYSGKXPZSBAQ-JTQLQIEISA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|