About 2,4-dimethylpentan-3-yl carbonochloridate
2,4-dimethylpentan-3-yl carbonochloridate (PubChem CID 11041290) has the molecular formula C8H15ClO2
and a molecular weight of 178.66 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl carbonochloridate.
Molecular Properties
| Compound Name | 2,4-dimethylpentan-3-yl carbonochloridate |
| PubChem CID | 11041290 |
| Molecular Formula | C8H15ClO2 |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2,4-dimethylpentan-3-yl carbonochloridate |
| SMILES | CC(C)C(OC(=O)Cl)C(C)C |
| InChI | InChI=1S/C8H15ClO2/c1-5(2)7(6(3)4)11-8(9)10/h5-7H,1-4H3 |
| InChIKey | WDBJMZSPVACLDL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpentan-3-yl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentan-3-yl carbonochloridate?
The IUPAC name of 2,4-dimethylpentan-3-yl carbonochloridate (CID 11041290) is 2,4-dimethylpentan-3-yl carbonochloridate.
What is the SMILES notation for 2,4-dimethylpentan-3-yl carbonochloridate?
The canonical SMILES for 2,4-dimethylpentan-3-yl carbonochloridate is CC(C)C(OC(=O)Cl)C(C)C.
What is the InChIKey of 2,4-dimethylpentan-3-yl carbonochloridate?
The InChIKey is WDBJMZSPVACLDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO2/c1-5(2)7(6(3)4)11-8(9)10/h5-7H,1-4H3.
What are the key properties of 2,4-dimethylpentan-3-yl carbonochloridate?
2,4-dimethylpentan-3-yl carbonochloridate has a molecular weight of 178.66 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentan-3-yl carbonochloridate is sourced from PubChem (CID 11041290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).