About 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine
1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine (PubChem CID 110413068) has the molecular formula C18H30N2O3S
and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine.
Molecular Properties
| Compound Name | 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine |
| PubChem CID | 110413068 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine |
| SMILES | COCCCN1C(C)CN(S(=O)(=O)Cc2ccccc2C)CC1C |
| InChI | InChI=1S/C18H30N2O3S/c1-15-8-5-6-9-18(15)14-24(21,22)19-12-16(2)20(17(3)13-19)10-7-11-23-4/h5-6,8-9,16-17H,7,10-14H2,1-4H3 |
| InChIKey | QGEZUMCMBSODPN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine?
The IUPAC name of 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine (CID 110413068) is 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine.
What is the SMILES notation for 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine?
The canonical SMILES for 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine is COCCCN1C(C)CN(S(=O)(=O)Cc2ccccc2C)CC1C.
What is the InChIKey of 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine?
The InChIKey is QGEZUMCMBSODPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O3S/c1-15-8-5-6-9-18(15)14-24(21,22)19-12-16(2)20(17(3)13-19)10-7-11-23-4/h5-6,8-9,16-17H,7,10-14H2,1-4H3.
What are the key properties of 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine?
1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine has a molecular weight of 354.52 g/mol, XLogP of 2.26, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxypropyl)-2,6-dimethyl-4-[(2-methylphenyl)methylsulfonyl]piperazine is sourced from PubChem (CID 110413068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).