C21H21ClN2O2 — CID 110413628
4-(4-chlorophenyl)-N-[2-(2-oxo-1H-quinolin-3-yl)ethyl]butanamide (PubChem CID 110413628) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[2-(2-oxo-1H-quinolin-3-yl)ethyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[2-(2-oxo-1H-quinolin-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 110413628 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[2-(2-oxo-1H-quinolin-3-yl)ethyl]butanamide |
| SMILES | O=C(CCCc1ccc(Cl)cc1)NCCc1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C21H21ClN2O2/c22-18-10-8-15(9-11-18)4-3-7-20(25)23-13-12-17-14-16-5-1-2-6-19(16)24-21(17)26/h1-2,5-6,8-11,14H,3-4,7,12-13H2,(H,23,25)(H,24,26) |
| InChIKey | FORXEGJTAZSIJF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |