About 5-amino-1-N-methylimidazole-1,4-dicarboxamide
5-amino-1-N-methylimidazole-1,4-dicarboxamide (PubChem CID 11041381) has the molecular formula C6H9N5O2
and a molecular weight of 183.17 g/mol. Its IUPAC name is 5-amino-1-N-methylimidazole-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 5-amino-1-N-methylimidazole-1,4-dicarboxamide |
| PubChem CID | 11041381 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 5-amino-1-N-methylimidazole-1,4-dicarboxamide |
| SMILES | CNC(=O)n1cnc(C(N)=O)c1N |
| InChI | InChI=1S/C6H9N5O2/c1-9-6(13)11-2-10-3(4(11)7)5(8)12/h2H,7H2,1H3,(H2,8,12)(H,9,13) |
| InChIKey | AGQNTADHDRGUOT-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-1-N-methylimidazole-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-N-methylimidazole-1,4-dicarboxamide?
The IUPAC name of 5-amino-1-N-methylimidazole-1,4-dicarboxamide (CID 11041381) is 5-amino-1-N-methylimidazole-1,4-dicarboxamide.
What is the SMILES notation for 5-amino-1-N-methylimidazole-1,4-dicarboxamide?
The canonical SMILES for 5-amino-1-N-methylimidazole-1,4-dicarboxamide is CNC(=O)n1cnc(C(N)=O)c1N.
What is the InChIKey of 5-amino-1-N-methylimidazole-1,4-dicarboxamide?
The InChIKey is AGQNTADHDRGUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5O2/c1-9-6(13)11-2-10-3(4(11)7)5(8)12/h2H,7H2,1H3,(H2,8,12)(H,9,13).
What are the key properties of 5-amino-1-N-methylimidazole-1,4-dicarboxamide?
5-amino-1-N-methylimidazole-1,4-dicarboxamide has a molecular weight of 183.17 g/mol, XLogP of -1.25, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-N-methylimidazole-1,4-dicarboxamide is sourced from PubChem (CID 11041381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).