C18H26ClN3O2 — CID 110413923
[4-[3-(3-chlorophenyl)propyl]piperazin-1-yl]-morpholin-4-ylmethanone (PubChem CID 110413923) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is [4-[3-(3-chlorophenyl)propyl]piperazin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[3-(3-chlorophenyl)propyl]piperazin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 110413923 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [4-[3-(3-chlorophenyl)propyl]piperazin-1-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1CCN(CCCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H26ClN3O2/c19-17-5-1-3-16(15-17)4-2-6-20-7-9-21(10-8-20)18(23)22-11-13-24-14-12-22/h1,3,5,15H,2,4,6-14H2 |
| InChIKey | JTTNWKZAFBIYPN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |