C22H22N4O2 — CID 1104159
(7R,7aS)-5-amino-7-(2,5-diethoxyphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile (PubChem CID 1104159) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is (7R,7aS)-5-amino-7-(2,5-diethoxyphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile.
| Compound Name | (7R,7aS)-5-amino-7-(2,5-diethoxyphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile |
|---|---|
| PubChem CID | 1104159 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (7R,7aS)-5-amino-7-(2,5-diethoxyphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile |
| SMILES | CCOc1ccc(OCC)c([C@@H]2[C@@H]3CCC=C3C(C#N)=C(N)C2(C#N)C#N)c1 |
| InChI | InChI=1S/C22H22N4O2/c1-3-27-14-8-9-19(28-4-2)17(10-14)20-16-7-5-6-15(16)18(11-23)21(26)22(20,12-24)13-25/h6,8-10,16,20H,3-5,7,26H2,1-2H3/t16-,20+/m1/s1 |
| InChIKey | MZSCQJOHTYMNIF-UZLBHIALSA-N |
| XLogP | 3.69 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|