C21H22FNO3 — CID 110416386
1-[2-(2-fluorophenyl)morpholin-4-yl]-5-phenylpentane-1,5-dione (PubChem CID 110416386) has the molecular formula C21H22FNO3 and a molecular weight of 355.41 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)morpholin-4-yl]-5-phenylpentane-1,5-dione.
| Compound Name | 1-[2-(2-fluorophenyl)morpholin-4-yl]-5-phenylpentane-1,5-dione |
|---|---|
| PubChem CID | 110416386 |
| Molecular Formula | C21H22FNO3 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[2-(2-fluorophenyl)morpholin-4-yl]-5-phenylpentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCOC(c2ccccc2F)C1)c1ccccc1 |
| InChI | InChI=1S/C21H22FNO3/c22-18-10-5-4-9-17(18)20-15-23(13-14-26-20)21(25)12-6-11-19(24)16-7-2-1-3-8-16/h1-5,7-10,20H,6,11-15H2 |
| InChIKey | PBVILSZSFDZWQM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |