About 2-(dimethoxymethyl)-1,3,5-trimethylbenzene
2-(dimethoxymethyl)-1,3,5-trimethylbenzene (PubChem CID 11041648) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-(dimethoxymethyl)-1,3,5-trimethylbenzene |
| PubChem CID | 11041648 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-(dimethoxymethyl)-1,3,5-trimethylbenzene |
| SMILES | COC(OC)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C12H18O2/c1-8-6-9(2)11(10(3)7-8)12(13-4)14-5/h6-7,12H,1-5H3 |
| InChIKey | RWFGNWVNQFFQIX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethoxymethyl)-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethoxymethyl)-1,3,5-trimethylbenzene?
The IUPAC name of 2-(dimethoxymethyl)-1,3,5-trimethylbenzene (CID 11041648) is 2-(dimethoxymethyl)-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-(dimethoxymethyl)-1,3,5-trimethylbenzene?
The canonical SMILES for 2-(dimethoxymethyl)-1,3,5-trimethylbenzene is COC(OC)c1c(C)cc(C)cc1C.
What is the InChIKey of 2-(dimethoxymethyl)-1,3,5-trimethylbenzene?
The InChIKey is RWFGNWVNQFFQIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-8-6-9(2)11(10(3)7-8)12(13-4)14-5/h6-7,12H,1-5H3.
What are the key properties of 2-(dimethoxymethyl)-1,3,5-trimethylbenzene?
2-(dimethoxymethyl)-1,3,5-trimethylbenzene has a molecular weight of 194.27 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethoxymethyl)-1,3,5-trimethylbenzene is sourced from PubChem (CID 11041648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).