C21H25NO2 — CID 110416741
N-[[1-(hydroxymethyl)cyclopentyl]methyl]-2,2-diphenylacetamide (PubChem CID 110416741) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclopentyl]methyl]-2,2-diphenylacetamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 110416741 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCC1(CO)CCCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c23-16-21(13-7-8-14-21)15-22-20(24)19(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,19,23H,7-8,13-16H2,(H,22,24) |
| InChIKey | FMEDGIABVDCGMQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |