C22H26FN3O — CID 110416916
[3-(4-fluorophenyl)-4-methylpiperazin-1-yl]-(4-pyrrolidin-1-ylphenyl)methanone (PubChem CID 110416916) has the molecular formula C22H26FN3O and a molecular weight of 367.47 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-4-methylpiperazin-1-yl]-(4-pyrrolidin-1-ylphenyl)methanone.
| Compound Name | [3-(4-fluorophenyl)-4-methylpiperazin-1-yl]-(4-pyrrolidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 110416916 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [3-(4-fluorophenyl)-4-methylpiperazin-1-yl]-(4-pyrrolidin-1-ylphenyl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(N3CCCC3)cc2)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FN3O/c1-24-14-15-26(16-21(24)17-4-8-19(23)9-5-17)22(27)18-6-10-20(11-7-18)25-12-2-3-13-25/h4-11,21H,2-3,12-16H2,1H3 |
| InChIKey | IJAYJUJJVXEBBH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |