C10H15NO3 — CID 11041702
N-[[(1R,2R,3S,4S)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methyl]acetamide (PubChem CID 11041702) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is N-[[(1R,2R,3S,4S)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methyl]acetamide.
| Compound Name | N-[[(1R,2R,3S,4S)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 11041702 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | N-[[(1R,2R,3S,4S)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1[C@@H](CO)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C10H15NO3/c1-6(13)11-4-7-8(5-12)10-3-2-9(7)14-10/h2-3,7-10,12H,4-5H2,1H3,(H,11,13)/t7-,8+,9+,10-/m0/s1 |
| InChIKey | BJSVYYZWUXJKBL-JLIMGVALSA-N |
| XLogP | -0.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|