C17H22N2O4S2 — CID 110417713
N-[3-[4-(methanesulfonamido)phenyl]propyl]-2-methylbenzenesulfonamide (PubChem CID 110417713) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[3-[4-(methanesulfonamido)phenyl]propyl]-2-methylbenzenesulfonamide.
| Compound Name | N-[3-[4-(methanesulfonamido)phenyl]propyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110417713 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[3-[4-(methanesulfonamido)phenyl]propyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)NCCCc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-14-6-3-4-8-17(14)25(22,23)18-13-5-7-15-9-11-16(12-10-15)19-24(2,20)21/h3-4,6,8-12,18-19H,5,7,13H2,1-2H3 |
| InChIKey | BZIVGEMBUQCVGM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|