C20H19FN2O2 — CID 110418371
N-(2,6-dimethylphenyl)-3-(7-fluoro-2-oxo-1H-quinolin-3-yl)propanamide (PubChem CID 110418371) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3-(7-fluoro-2-oxo-1H-quinolin-3-yl)propanamide.
| Compound Name | N-(2,6-dimethylphenyl)-3-(7-fluoro-2-oxo-1H-quinolin-3-yl)propanamide |
|---|---|
| PubChem CID | 110418371 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3-(7-fluoro-2-oxo-1H-quinolin-3-yl)propanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCc1cc2ccc(F)cc2[nH]c1=O |
| InChI | InChI=1S/C20H19FN2O2/c1-12-4-3-5-13(2)19(12)23-18(24)9-7-15-10-14-6-8-16(21)11-17(14)22-20(15)25/h3-6,8,10-11H,7,9H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | DLRXOZKSNWAJEZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |