C19H29N3O5 — CID 110418747
1-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl]-3-(2-methoxyethyl)urea (PubChem CID 110418747) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 110418747 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]methyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NCC1CC(=O)N(CCc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C19H29N3O5/c1-25-9-7-20-19(24)21-12-15-11-18(23)22(13-15)8-6-14-4-5-16(26-2)17(10-14)27-3/h4-5,10,15H,6-9,11-13H2,1-3H3,(H2,20,21,24) |
| InChIKey | SZTDOHRNHSNCME-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|