C14H21F3N2O4S — CID 110418951
N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 110418951) has the molecular formula C14H21F3N2O4S and a molecular weight of 370.39 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110418951 |
| Molecular Formula | C14H21F3N2O4S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[3-(1,1-dioxothiolan-3-yl)propyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCC1CCS(=O)(=O)C1)C1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O4S/c15-14(16,17)13(21)19-7-2-4-11(19)12(20)18-6-1-3-10-5-8-24(22,23)9-10/h10-11H,1-9H2,(H,18,20) |
| InChIKey | NNOATTZYKIBTQN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|