About 2-phenylmethoxyhexanal
2-phenylmethoxyhexanal (PubChem CID 11041921) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-phenylmethoxyhexanal.
Molecular Properties
| Compound Name | 2-phenylmethoxyhexanal |
| PubChem CID | 11041921 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-phenylmethoxyhexanal |
| SMILES | CCCCC(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-2-3-9-13(10-14)15-11-12-7-5-4-6-8-12/h4-8,10,13H,2-3,9,11H2,1H3 |
| InChIKey | XJNJIYJKWNSIHC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylmethoxyhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxyhexanal?
The IUPAC name of 2-phenylmethoxyhexanal (CID 11041921) is 2-phenylmethoxyhexanal.
What is the SMILES notation for 2-phenylmethoxyhexanal?
The canonical SMILES for 2-phenylmethoxyhexanal is CCCCC(C=O)OCc1ccccc1.
What is the InChIKey of 2-phenylmethoxyhexanal?
The InChIKey is XJNJIYJKWNSIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-2-3-9-13(10-14)15-11-12-7-5-4-6-8-12/h4-8,10,13H,2-3,9,11H2,1H3.
What are the key properties of 2-phenylmethoxyhexanal?
2-phenylmethoxyhexanal has a molecular weight of 206.29 g/mol, XLogP of 2.96, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxyhexanal is sourced from PubChem (CID 11041921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).