C18H15F3N2O3 — CID 110420415
3-(4-methoxyphenyl)-4-(2,3,4-trifluorobenzoyl)piperazin-2-one (PubChem CID 110420415) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-(2,3,4-trifluorobenzoyl)piperazin-2-one.
| Compound Name | 3-(4-methoxyphenyl)-4-(2,3,4-trifluorobenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 110420415 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-(2,3,4-trifluorobenzoyl)piperazin-2-one |
| SMILES | COc1ccc(C2C(=O)NCCN2C(=O)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H15F3N2O3/c1-26-11-4-2-10(3-5-11)16-17(24)22-8-9-23(16)18(25)12-6-7-13(19)15(21)14(12)20/h2-7,16H,8-9H2,1H3,(H,22,24) |
| InChIKey | YLNOEOKNMOVNJF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|