C10H12O5 — CID 11042057
methyl (1S,4S,5S)-4-ethenyl-6-oxo-2,8-dioxabicyclo[3.2.1]octane-5-carboxylate (PubChem CID 11042057) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is methyl (1S,4S,5S)-4-ethenyl-6-oxo-2,8-dioxabicyclo[3.2.1]octane-5-carboxylate.
| Compound Name | methyl (1S,4S,5S)-4-ethenyl-6-oxo-2,8-dioxabicyclo[3.2.1]octane-5-carboxylate |
|---|---|
| PubChem CID | 11042057 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | methyl (1S,4S,5S)-4-ethenyl-6-oxo-2,8-dioxabicyclo[3.2.1]octane-5-carboxylate |
| SMILES | C=C[C@H]1CO[C@@H]2CC(=O)[C@@]1(C(=O)OC)O2 |
| InChI | InChI=1S/C10H12O5/c1-3-6-5-14-8-4-7(11)10(6,15-8)9(12)13-2/h3,6,8H,1,4-5H2,2H3/t6-,8-,10-/m0/s1 |
| InChIKey | YEEBOZSQXGNNGO-HKPALBBZSA-N |
| XLogP | 0.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|