About 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one
2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one (PubChem CID 11042067) has the molecular formula C10H12O3S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one |
| PubChem CID | 11042067 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one |
| SMILES | O=C1CCCC=C1C1=CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H12O3S/c11-10-4-2-1-3-9(10)8-5-6-14(12,13)7-8/h3,5H,1-2,4,6-7H2 |
| InChIKey | BJWZILIWNOCKPK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one?
The IUPAC name of 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one (CID 11042067) is 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one.
What is the SMILES notation for 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one?
The canonical SMILES for 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one is O=C1CCCC=C1C1=CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one?
The InChIKey is BJWZILIWNOCKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3S/c11-10-4-2-1-3-9(10)8-5-6-14(12,13)7-8/h3,5H,1-2,4,6-7H2.
What are the key properties of 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one?
2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one has a molecular weight of 212.27 g/mol, XLogP of 1.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-2,5-dihydrothiophen-3-yl)cyclohex-2-en-1-one is sourced from PubChem (CID 11042067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).