C10H14O5 — CID 11042101
2,2-dimethyl-5-(3-oxobutyl)-1,3-dioxane-4,6-dione (PubChem CID 11042101) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-oxobutyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(3-oxobutyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11042101 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2,2-dimethyl-5-(3-oxobutyl)-1,3-dioxane-4,6-dione |
| SMILES | CC(=O)CCC1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C10H14O5/c1-6(11)4-5-7-8(12)14-10(2,3)15-9(7)13/h7H,4-5H2,1-3H3 |
| InChIKey | OPAKERNVOIXBSQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|