C12H16N2O6S2 — CID 110421080
N-methoxy-2-methyl-4-(4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide (PubChem CID 110421080) has the molecular formula C12H16N2O6S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-methoxy-2-methyl-4-(4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide.
| Compound Name | N-methoxy-2-methyl-4-(4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110421080 |
| Molecular Formula | C12H16N2O6S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-methoxy-2-methyl-4-(4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)benzenesulfonamide |
| SMILES | CONS(=O)(=O)c1ccc(N2C(=O)C(C)CS2(=O)=O)cc1C |
| InChI | InChI=1S/C12H16N2O6S2/c1-8-6-10(4-5-11(8)22(18,19)13-20-3)14-12(15)9(2)7-21(14,16)17/h4-6,9,13H,7H2,1-3H3 |
| InChIKey | XWFFQQAMKLKVHM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|