C21H21N3O4 — CID 110421281
N-[3-(4-hydroxyphenyl)propyl]-4-(4-methoxyphenyl)-2-oxo-1H-pyrimidine-6-carboxamide (PubChem CID 110421281) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[3-(4-hydroxyphenyl)propyl]-4-(4-methoxyphenyl)-2-oxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[3-(4-hydroxyphenyl)propyl]-4-(4-methoxyphenyl)-2-oxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110421281 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[3-(4-hydroxyphenyl)propyl]-4-(4-methoxyphenyl)-2-oxo-1H-pyrimidine-6-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCCc3ccc(O)cc3)[nH]c(=O)n2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-28-17-10-6-15(7-11-17)18-13-19(24-21(27)23-18)20(26)22-12-2-3-14-4-8-16(25)9-5-14/h4-11,13,25H,2-3,12H2,1H3,(H,22,26)(H,23,24,27) |
| InChIKey | CYDRCFWKJNDNJZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|