About N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide
N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide (PubChem CID 110421882) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide.
Molecular Properties
| Compound Name | N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide |
| PubChem CID | 110421882 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide |
| SMILES | CC(=O)NCCC(=O)N1CC(C)OCC1(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-9-7-14(12(3,4)8-17-9)11(16)5-6-13-10(2)15/h9H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | BFVQDCYJSSTVIQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide?
The IUPAC name of N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide (CID 110421882) is N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide.
What is the SMILES notation for N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide?
The canonical SMILES for N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide is CC(=O)NCCC(=O)N1CC(C)OCC1(C)C.
What is the InChIKey of N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide?
The InChIKey is BFVQDCYJSSTVIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-9-7-14(12(3,4)8-17-9)11(16)5-6-13-10(2)15/h9H,5-8H2,1-4H3,(H,13,15).
What are the key properties of N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide?
N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide has a molecular weight of 242.32 g/mol, XLogP of 0.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-oxo-3-(2,5,5-trimethylmorpholin-4-yl)propyl]acetamide is sourced from PubChem (CID 110421882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).