C19H21NO4 — CID 110423070
N-(2,4-dimethoxyphenyl)-4-(2-methylphenyl)-4-oxobutanamide (PubChem CID 110423070) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(2-methylphenyl)-4-oxobutanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(2-methylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 110423070 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(2-methylphenyl)-4-oxobutanamide |
| SMILES | COc1ccc(NC(=O)CCC(=O)c2ccccc2C)c(OC)c1 |
| InChI | InChI=1S/C19H21NO4/c1-13-6-4-5-7-15(13)17(21)10-11-19(22)20-16-9-8-14(23-2)12-18(16)24-3/h4-9,12H,10-11H2,1-3H3,(H,20,22) |
| InChIKey | WHQJXEQLVABNOF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |