C23H24F2N2O2 — CID 110426002
4-[3-cyclopropyl-3-(4-fluoro-3-methylphenyl)propanoyl]-3-(4-fluorophenyl)piperazin-2-one (PubChem CID 110426002) has the molecular formula C23H24F2N2O2 and a molecular weight of 398.45 g/mol. Its IUPAC name is 4-[3-cyclopropyl-3-(4-fluoro-3-methylphenyl)propanoyl]-3-(4-fluorophenyl)piperazin-2-one.
| Compound Name | 4-[3-cyclopropyl-3-(4-fluoro-3-methylphenyl)propanoyl]-3-(4-fluorophenyl)piperazin-2-one |
|---|---|
| PubChem CID | 110426002 |
| Molecular Formula | C23H24F2N2O2 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[3-cyclopropyl-3-(4-fluoro-3-methylphenyl)propanoyl]-3-(4-fluorophenyl)piperazin-2-one |
| SMILES | Cc1cc(C(CC(=O)N2CCNC(=O)C2c2ccc(F)cc2)C2CC2)ccc1F |
| InChI | InChI=1S/C23H24F2N2O2/c1-14-12-17(6-9-20(14)25)19(15-2-3-15)13-21(28)27-11-10-26-23(29)22(27)16-4-7-18(24)8-5-16/h4-9,12,15,19,22H,2-3,10-11,13H2,1H3,(H,26,29) |
| InChIKey | OVKOJHHPVFETIS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |