About (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine
(6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine (PubChem CID 11042602) has the molecular formula C13H26ClN
and a molecular weight of 231.81 g/mol. Its IUPAC name is (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine.
Molecular Properties
| Compound Name | (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine |
| PubChem CID | 11042602 |
| Molecular Formula | C13H26ClN |
| Molecular Weight | 231.81 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine |
| SMILES | CC/C(=N\C(C)C)C(C)(Cl)C[C@@H](C)CC |
| InChI | InChI=1S/C13H26ClN/c1-7-11(5)9-13(6,14)12(8-2)15-10(3)4/h10-11H,7-9H2,1-6H3/b15-12+/t11-,13?/m0/s1 |
| InChIKey | GXLCURMNUMZARW-OPNIQGFTSA-N |
| XLogP | 4.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.81 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine?
The IUPAC name of (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine (CID 11042602) is (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine.
What is the SMILES notation for (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine?
The canonical SMILES for (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine is CC/C(=N\C(C)C)C(C)(Cl)C[C@@H](C)CC.
What is the InChIKey of (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine?
The InChIKey is GXLCURMNUMZARW-OPNIQGFTSA-N. The full InChI is InChI=1S/C13H26ClN/c1-7-11(5)9-13(6,14)12(8-2)15-10(3)4/h10-11H,7-9H2,1-6H3/b15-12+/t11-,13?/m0/s1.
What are the key properties of (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine?
(6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine has a molecular weight of 231.81 g/mol, XLogP of 4.68, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-4-chloro-4,6-dimethyl-N-propan-2-yloctan-3-imine is sourced from PubChem (CID 11042602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).