About (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one
(3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 11042617) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| PubChem CID | 11042617 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | COc1ccc2c(c1)[C@@]1(CCN(C)C1)C(=O)N2 |
| InChI | InChI=1S/C13H16N2O2/c1-15-6-5-13(8-15)10-7-9(17-2)3-4-11(10)14-12(13)16/h3-4,7H,5-6,8H2,1-2H3,(H,14,16)/t13-/m0/s1 |
| InChIKey | RVOLLKGLJIUGLG-ZDUSSCGKSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one?
The IUPAC name of (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one (CID 11042617) is (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
What is the SMILES notation for (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one?
The canonical SMILES for (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one is COc1ccc2c(c1)[C@@]1(CCN(C)C1)C(=O)N2.
What is the InChIKey of (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one?
The InChIKey is RVOLLKGLJIUGLG-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H16N2O2/c1-15-6-5-13(8-15)10-7-9(17-2)3-4-11(10)14-12(13)16/h3-4,7H,5-6,8H2,1-2H3,(H,14,16)/t13-/m0/s1.
What are the key properties of (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one?
(3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one has a molecular weight of 232.28 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-methoxy-1'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one is sourced from PubChem (CID 11042617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).