About N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide
N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide (PubChem CID 11042638) has the molecular formula C11H14F3NO
and a molecular weight of 233.23 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide.
Molecular Properties
| Compound Name | N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide |
| PubChem CID | 11042638 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)C(F)(F)F)C1C=CCCC1 |
| InChI | InChI=1S/C11H14F3NO/c1-2-8-15(10(16)11(12,13)14)9-6-4-3-5-7-9/h2,4,6,9H,1,3,5,7-8H2 |
| InChIKey | KITMVXNFBYTAII-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide?
The IUPAC name of N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide (CID 11042638) is N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide.
What is the SMILES notation for N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide?
The canonical SMILES for N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide is C=CCN(C(=O)C(F)(F)F)C1C=CCCC1.
What is the InChIKey of N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide?
The InChIKey is KITMVXNFBYTAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO/c1-2-8-15(10(16)11(12,13)14)9-6-4-3-5-7-9/h2,4,6,9H,1,3,5,7-8H2.
What are the key properties of N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide?
N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide has a molecular weight of 233.23 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohex-2-en-1-yl-2,2,2-trifluoro-N-prop-2-enylacetamide is sourced from PubChem (CID 11042638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).