C23H28N4O2 — CID 110428231
N-[4-(diethylamino)-2-methylphenyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanamide (PubChem CID 110428231) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 110428231 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-phenylpropanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CC(c2ccccc2)c2nnc(C)o2)c(C)c1 |
| InChI | InChI=1S/C23H28N4O2/c1-5-27(6-2)19-12-13-21(16(3)14-19)24-22(28)15-20(18-10-8-7-9-11-18)23-26-25-17(4)29-23/h7-14,20H,5-6,15H2,1-4H3,(H,24,28) |
| InChIKey | QIZNCJUIGFQMHV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|