C15H31NO — CID 11042890
(2S,3R)-3-prop-2-enoxydodecan-2-amine (PubChem CID 11042890) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is (2S,3R)-3-prop-2-enoxydodecan-2-amine.
| Compound Name | (2S,3R)-3-prop-2-enoxydodecan-2-amine |
|---|---|
| PubChem CID | 11042890 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | (2S,3R)-3-prop-2-enoxydodecan-2-amine |
| SMILES | C=CCO[C@H](CCCCCCCCC)[C@H](C)N |
| InChI | InChI=1S/C15H31NO/c1-4-6-7-8-9-10-11-12-15(14(3)16)17-13-5-2/h5,14-15H,2,4,6-13,16H2,1,3H3/t14-,15+/m0/s1 |
| InChIKey | VPBSKMRVFLTDMO-LSDHHAIUSA-N |
| XLogP | 4.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|