C17H24O — CID 11042990
(1S,6S)-3-(2-phenylmethoxypropan-2-yl)bicyclo[4.1.0]heptane (PubChem CID 11042990) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (1S,6S)-3-(2-phenylmethoxypropan-2-yl)bicyclo[4.1.0]heptane.
| Compound Name | (1S,6S)-3-(2-phenylmethoxypropan-2-yl)bicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 11042990 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (1S,6S)-3-(2-phenylmethoxypropan-2-yl)bicyclo[4.1.0]heptane |
| SMILES | CC(C)(OCc1ccccc1)C1CC[C@H]2C[C@H]2C1 |
| InChI | InChI=1S/C17H24O/c1-17(2,16-9-8-14-10-15(14)11-16)18-12-13-6-4-3-5-7-13/h3-7,14-16H,8-12H2,1-2H3/t14-,15-,16?/m0/s1 |
| InChIKey | NEPKTLNMBTULIH-KSCSMHSMSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |