C12H18N4O2 — CID 110430260
N-(2,2-dimethoxyethyl)-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 110430260) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110430260 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COC(CNc1nc(C)nc2[nH]c(C)cc12)OC |
| InChI | InChI=1S/C12H18N4O2/c1-7-5-9-11(13-6-10(17-3)18-4)15-8(2)16-12(9)14-7/h5,10H,6H2,1-4H3,(H2,13,14,15,16) |
| InChIKey | BBWJVKZWPZJVNK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|