About [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate
[(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate (PubChem CID 11043038) has the molecular formula C10H14O5S
and a molecular weight of 246.28 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate |
| PubChem CID | 11043038 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)CO)cc1 |
| InChI | InChI=1S/C10H14O5S/c1-8-2-4-10(5-3-8)16(13,14)15-7-9(12)6-11/h2-5,9,11-12H,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | DFQNMODTAFTGHS-VIFPVBQESA-N |
| XLogP | 0.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate?
The IUPAC name of [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate (CID 11043038) is [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate?
The canonical SMILES for [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC[C@@H](O)CO)cc1.
What is the InChIKey of [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate?
The InChIKey is DFQNMODTAFTGHS-VIFPVBQESA-N. The full InChI is InChI=1S/C10H14O5S/c1-8-2-4-10(5-3-8)16(13,14)15-7-9(12)6-11/h2-5,9,11-12H,6-7H2,1H3/t9-/m0/s1.
What are the key properties of [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate?
[(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate has a molecular weight of 246.28 g/mol, XLogP of 0.05, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 11043038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).