C17H27N5 — CID 110430692
2,6-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 110430692) has the molecular formula C17H27N5 and a molecular weight of 301.44 g/mol. Its IUPAC name is 2,6-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2,6-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110430692 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 2,6-dimethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(NC2CC(C)(C)NC(C)(C)C2)c2cc(C)[nH]c2n1 |
| InChI | InChI=1S/C17H27N5/c1-10-7-13-14(18-10)19-11(2)20-15(13)21-12-8-16(3,4)22-17(5,6)9-12/h7,12,22H,8-9H2,1-6H3,(H2,18,19,20,21) |
| InChIKey | OMXPHTNDGJCMGM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |